Products 186498-24-8
CAS 186498-24-8 appears in our catalog under these names: 4-Butyrylphenylboronic acid, 98%, (4-Butyrylphenyl)boronic acid 98%, (4-Butyrylphenyl)boronic acid, 98%, 98%, (4-Butyrylphenyl)boronic acid, 98%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg.
(4-butanoylphenyl)boronic acid (CAS 186498-24-8) is a chemical compound with the molecular formula C10H13BO3 and a molecular weight of 192.02 g/mol. IUPAC name: (4-butanoylphenyl)boronic acid. InChIKey: IGYWRXHZSLSNLZ-UHFFFAOYSA-N.
| Molecular formula | C10H13BO3 |
|---|---|
| Molecular weight | 192.02 g/mol |
| IUPAC name | (4-butanoylphenyl)boronic acid |
| InChIKey | IGYWRXHZSLSNLZ-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)C(=O)CCC)(O)O |
Computed by PubChem (NCBI)