Products 2377608-31-4
CAS 2377608-31-4 appears in our catalog under these names: 3-(Isobutanoy)phenylboronic acid, 96%, (3-Isobutyrylphenyl)boronic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g.
[3-(2-methylpropanoyl)phenyl]boronic acid (CAS 2377608-31-4) is a chemical compound with the molecular formula C10H13BO3 and a molecular weight of 192.02 g/mol. IUPAC name: [3-(2-methylpropanoyl)phenyl]boronic acid. InChIKey: FCFJZCTYFIECHV-UHFFFAOYSA-N.
| Molecular formula | C10H13BO3 |
|---|---|
| Molecular weight | 192.02 g/mol |
| IUPAC name | [3-(2-methylpropanoyl)phenyl]boronic acid |
| InChIKey | FCFJZCTYFIECHV-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC=C1)C(=O)C(C)C)(O)O |
Computed by PubChem (NCBI)