CAS 411229-67-9 appears in our catalog under these names: 4-(Cyclopropylmethoxy)phenylboronic acid, 98%, 4-(Cyclopropylmethoxy)phenylboronic acid, 95-<97%, 4-(Cyclopropylmethoxy)phenylboronic acid, ≥97-<99%, 4-(Cyclopropylmethoxy)phenylboronic acid, (4-(Cyclopropylmethoxy)phenyl)boronic acid 98%. Offered by: Combi-blocks, Hoffman Fine Chemicals, Biosynth, Ambeed, Chemat. Available pack sizes: 1g, 25g, 10g, 5g, 50g, 100g, 200g, 300g.
[4-(cyclopropylmethoxy)phenyl]boronic acid (CAS 411229-67-9) is a chemical compound with the molecular formula C10H13BO3 and a molecular weight of 192.02 g/mol. IUPAC name: [4-(cyclopropylmethoxy)phenyl]boronic acid. InChIKey: AYJVDOMUBHORKK-UHFFFAOYSA-N.
| Molecular formula | C10H13BO3 |
|---|---|
| Molecular weight | 192.02 g/mol |
| IUPAC name | [4-(cyclopropylmethoxy)phenyl]boronic acid |
| InChIKey | AYJVDOMUBHORKK-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)OCC2CC2)(O)O |
Computed by PubChem (NCBI)