Products 186498-27-1
CAS 186498-27-1 appears in our catalog under these names: 4-Isobutyrylphenylboronic acid, 97%, (4-Isobutyrylphenyl)Boronic Acid, 95%+, 95%+, (4-Isobutyrylphenyl)boronic acid, 95%+, (4-Isobutyrylphenyl)boronic acid, 98%. Offered by: Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 5g, 1g, 100mg, 250mg.
[4-(2-methylpropanoyl)phenyl]boronic acid (CAS 186498-27-1) is a chemical compound with the molecular formula C10H13BO3 and a molecular weight of 192.02 g/mol. IUPAC name: [4-(2-methylpropanoyl)phenyl]boronic acid. InChIKey: CFUNNCDOCRSHJT-UHFFFAOYSA-N.
| Molecular formula | C10H13BO3 |
|---|---|
| Molecular weight | 192.02 g/mol |
| IUPAC name | [4-(2-methylpropanoyl)phenyl]boronic acid |
| InChIKey | CFUNNCDOCRSHJT-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)C(=O)C(C)C)(O)O |
Computed by PubChem (NCBI)