cas: 849062-16-4 — see every product listed under this CAS number, including other names
(4-Isopropoxy-3,5-dimethylphenyl)boronic acid, 98% (CAS 849062-16-4) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A384794-1g |
| cas | 849062-16-4 |
| size | 1g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 1g | 239.26 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
(3,5-dimethyl-4-propan-2-yloxyphenyl)boronic acid (CAS 849062-16-4) is a chemical compound with the molecular formula C11H17BO3 and a molecular weight of 208.06 g/mol. IUPAC name: (3,5-dimethyl-4-propan-2-yloxyphenyl)boronic acid. InChIKey: OESNXDCMAFEMMC-UHFFFAOYSA-N.
| Molecular formula | C11H17BO3 |
|---|---|
| Molecular weight | 208.06 g/mol |
| IUPAC name | (3,5-dimethyl-4-propan-2-yloxyphenyl)boronic acid |
| InChIKey | OESNXDCMAFEMMC-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C(=C1)C)OC(C)C)C)(O)O |
Computed by PubChem (NCBI)