cas: 4160-63-8 — see every product listed under this CAS number, including other names
(4-Methoxyphenyl)(thiophen-2-yl)methanone 98% (CAS 4160-63-8) is a chemical reagent available from Chemat. Available pack sizes: 100g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A320704-100g |
| cas | 4160-63-8 |
| size | 100g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100g | 3084.88 Pln | |
| Ambeed | 5g | 325.88 Pln | |
| Ambeed | 25g | 909.94 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A320704 |
(4-methoxyphenyl)-thiophen-2-ylmethanone (CAS 4160-63-8) is a chemical compound with the molecular formula C12H10O2S and a molecular weight of 218.27 g/mol. IUPAC name: (4-methoxyphenyl)-thiophen-2-ylmethanone. InChIKey: KYVBFEMQEUXVQB-UHFFFAOYSA-N.
| Molecular formula | C12H10O2S |
|---|---|
| Molecular weight | 218.27 g/mol |
| IUPAC name | (4-methoxyphenyl)-thiophen-2-ylmethanone |
| InChIKey | KYVBFEMQEUXVQB-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C(=O)C2=CC=CS2 |
Computed by PubChem (NCBI)