cas: 947533-94-0 — see every product listed under this CAS number, including other names
(4-Methyl-3-(trifluoromethyl)phenyl)boronic acid, 98% (CAS 947533-94-0) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F330130-50MG |
| cas | 947533-94-0 |
| size | 50mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 50mg | 263.47 Pln | |
| Fluorochem | 100mg | 320.74 Pln | |
| Fluorochem | 250mg | 372.80 Pln | |
| Fluorochem | 1g | 607.10 Pln | |
| Fluorochem | 5g | 2106.57 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
[4-methyl-3-(trifluoromethyl)phenyl]boronic acid (CAS 947533-94-0) is a chemical compound with the molecular formula C8H8BF3O2 and a molecular weight of 203.96 g/mol. IUPAC name: [4-methyl-3-(trifluoromethyl)phenyl]boronic acid. InChIKey: LXQGVSGCAAPNEL-UHFFFAOYSA-N.
| Molecular formula | C8H8BF3O2 |
|---|---|
| Molecular weight | 203.96 g/mol |
| IUPAC name | [4-methyl-3-(trifluoromethyl)phenyl]boronic acid |
| InChIKey | LXQGVSGCAAPNEL-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)C)C(F)(F)F)(O)O |
Computed by PubChem (NCBI)