(4-Methylbenzyl)hydrazine hydrochloride, 95%, 95%
cas: 26177-51-5 — see every product listed under this CAS number, including other names
(4-Methylbenzyl)hydrazine hydrochloride, 95%, 95% (CAS 26177-51-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113S4F-100mg |
| cas | 26177-51-5 |
| size | 100mg |
| availability | 75g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 117.20 Pln | |
| Chemat | 250mg | 160.40 Pln | |
| Chemat | 1g | 352.40 Pln | |
| Chemat | 5g | 1221.20 Pln | |
| Chemat | 10g | 1566.80 Pln | |
| Chemat | 25g | 3040.40 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
[(4-methylphenyl)methylamino]azanium chloride (CAS 26177-51-5) is a chemical compound with the molecular formula C8H13ClN2 and a molecular weight of 172.65 g/mol. IUPAC name: [(4-methylphenyl)methylamino]azanium chloride. InChIKey: FZDQALMNASCCIY-UHFFFAOYSA-N.
| Molecular formula | C8H13ClN2 |
|---|---|
| Molecular weight | 172.65 g/mol |
| IUPAC name | [(4-methylphenyl)methylamino]azanium chloride |
| InChIKey | FZDQALMNASCCIY-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)CN[NH3+].[Cl-] |
Computed by PubChem (NCBI)