cas: 26177-51-5 — see every product listed under this CAS number, including other names
(4-Methylbenzyl)hydrazine hydrochloride, 97% (CAS 26177-51-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 100g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A611898-1g |
| cas | 26177-51-5 |
| size | 1g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 1g | 1280.86 Pln | |
| AmBeed | 100g | 21819.91 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
[(4-methylphenyl)methylamino]azanium chloride (CAS 26177-51-5) is a chemical compound with the molecular formula C8H13ClN2 and a molecular weight of 172.65 g/mol. IUPAC name: [(4-methylphenyl)methylamino]azanium chloride. InChIKey: FZDQALMNASCCIY-UHFFFAOYSA-N.
| Molecular formula | C8H13ClN2 |
|---|---|
| Molecular weight | 172.65 g/mol |
| IUPAC name | [(4-methylphenyl)methylamino]azanium chloride |
| InChIKey | FZDQALMNASCCIY-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)CN[NH3+].[Cl-] |
Computed by PubChem (NCBI)