cas: 17547-79-4 — see every product listed under this CAS number, including other names
(4-Oxo-2,3,4,5-tetrahydro-1,5-benzothiazepin-3-yl)acetic acid, 97% (CAS 17547-79-4) is a chemical reagent available from Chemat. Available pack sizes: 250MG, 1g. Offered by: Thermo Scientific.
| brand | Thermo Scientific |
|---|---|
| catalog number | CC71601CB |
| cas | 17547-79-4 |
| size | 250MG |
| brand | size | price | |
|---|---|---|---|
| Thermo Scientific | 250MG | 549.81 Pln | |
| Thermo Scientific | 1g | 1369.43 Pln |
| delivery time | 2-3 weeks |
|---|---|
| category | Chemicals |
| purity | 97% |
2-(4-oxo-3,5-dihydro-2H-1,5-benzothiazepin-3-yl)acetic acid (CAS 17547-79-4) is a chemical compound with the molecular formula C11H11NO3S and a molecular weight of 237.28 g/mol. IUPAC name: 2-(4-oxo-3,5-dihydro-2H-1,5-benzothiazepin-3-yl)acetic acid. InChIKey: VCSCQLDBPVHQPW-UHFFFAOYSA-N.
| Molecular formula | C11H11NO3S |
|---|---|
| Molecular weight | 237.28 g/mol |
| IUPAC name | 2-(4-oxo-3,5-dihydro-2H-1,5-benzothiazepin-3-yl)acetic acid |
| InChIKey | VCSCQLDBPVHQPW-UHFFFAOYSA-N |
| SMILES | C1C(C(=O)NC2=CC=CC=C2S1)CC(=O)O |
Computed by PubChem (NCBI)