CAS 17547-79-4 appears in our catalog under these names: (4-Oxo-2,3,4,5-tetrahydro-1,5-benzothiazepin-3-yl)acetic acid, 95%, (4-Oxo-2,3,4,5-tetrahydro-1,5-benzothiazepin-3-yl)acetic acid, 97% . Offered by: Combi-blocks, Thermo Scientific. Available pack sizes: 1g, 250mg.
2-(4-oxo-3,5-dihydro-2H-1,5-benzothiazepin-3-yl)acetic acid (CAS 17547-79-4) is a chemical compound with the molecular formula C11H11NO3S and a molecular weight of 237.28 g/mol. IUPAC name: 2-(4-oxo-3,5-dihydro-2H-1,5-benzothiazepin-3-yl)acetic acid. InChIKey: VCSCQLDBPVHQPW-UHFFFAOYSA-N.
| Molecular formula | C11H11NO3S |
|---|---|
| Molecular weight | 237.28 g/mol |
| IUPAC name | 2-(4-oxo-3,5-dihydro-2H-1,5-benzothiazepin-3-yl)acetic acid |
| InChIKey | VCSCQLDBPVHQPW-UHFFFAOYSA-N |
| SMILES | C1C(C(=O)NC2=CC=CC=C2S1)CC(=O)O |
Computed by PubChem (NCBI)