CAS 37012-79-6 appears in our catalog under these names: 3-(3-Oxo-2,3-dihydro-4h-1,4-benzothiazin-4-yl)propanoic acid, 95%, 3-(3-Oxo-2H-benzo(b)(1,4)thiazin-4(3H)-yl)propanoic acid, 97%, 3-(3-Oxo-3,4-dihydro-2H-1,4-benzothiazin-4-yl)propanoic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg, 0,5g.
3-(3-oxo-1,4-benzothiazin-4-yl)propanoic acid (CAS 37012-79-6) is a chemical compound with the molecular formula C11H11NO3S and a molecular weight of 237.28 g/mol. IUPAC name: 3-(3-oxo-1,4-benzothiazin-4-yl)propanoic acid. InChIKey: HLKRXKOGJJRTKX-UHFFFAOYSA-N.
| Molecular formula | C11H11NO3S |
|---|---|
| Molecular weight | 237.28 g/mol |
| IUPAC name | 3-(3-oxo-1,4-benzothiazin-4-yl)propanoic acid |
| InChIKey | HLKRXKOGJJRTKX-UHFFFAOYSA-N |
| SMILES | C1C(=O)N(C2=CC=CC=C2S1)CCC(=O)O |
Computed by PubChem (NCBI)