Products 32187-00-1
CAS 32187-00-1 is the registry number for Ethyl 2-methyl-5-oxo-[1,3]thiazolo[3,2-a]pyridine-6-carboxylate, 98%. Offered by: Combi-blocks. Available pack sizes: 25g, 5g, 1g.
Ethyl 2-methyl-5-oxo-[1,3]thiazolo[3,2-a]pyridine-6-carboxylate (CAS 32187-00-1) is a chemical compound with the molecular formula C11H11NO3S and a molecular weight of 237.28 g/mol. IUPAC name: ethyl 2-methyl-5-oxo-[1,3]thiazolo[3,2-a]pyridine-6-carboxylate. InChIKey: KQYKSUKMKCRTQU-UHFFFAOYSA-N.
| Molecular formula | C11H11NO3S |
|---|---|
| Molecular weight | 237.28 g/mol |
| IUPAC name | ethyl 2-methyl-5-oxo-[1,3]thiazolo[3,2-a]pyridine-6-carboxylate |
| InChIKey | KQYKSUKMKCRTQU-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC=C2N(C1=O)C=C(S2)C |
Computed by PubChem (NCBI)