CAS 204863-53-6 appears in our catalog under these names: Ethyl 3-oxo-3,4-dihydro-2h-benzo[b][1,4]thiazine-6-carboxylate, 95%, Ethyl 3-oxo-3,4-dihydro-2H-benzo(b)(1,4)thiazine-6-carboxylate, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 10g.
Ethyl 3-oxo-4H-1,4-benzothiazine-6-carboxylate (CAS 204863-53-6) is a chemical compound with the molecular formula C11H11NO3S and a molecular weight of 237.28 g/mol. IUPAC name: ethyl 3-oxo-4H-1,4-benzothiazine-6-carboxylate. InChIKey: ANIBMWZLVBRBFZ-UHFFFAOYSA-N.
| Molecular formula | C11H11NO3S |
|---|---|
| Molecular weight | 237.28 g/mol |
| IUPAC name | ethyl 3-oxo-4H-1,4-benzothiazine-6-carboxylate |
| InChIKey | ANIBMWZLVBRBFZ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC2=C(C=C1)SCC(=O)N2 |
Computed by PubChem (NCBI)