Products 342778-82-9

CAS 342778-82-9 is the registry number for 3-(1,3-Benzothiazol-2-yl)-3-methoxypropanoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 250mg, 1g.

Structural formula: {0} (CAS {1})

3-(1,3-benzothiazol-2-yl)-3-methoxypropanoic acid (CAS 342778-82-9) is a chemical compound with the molecular formula C11H11NO3S and a molecular weight of 237.28 g/mol. IUPAC name: 3-(1,3-benzothiazol-2-yl)-3-methoxypropanoic acid. InChIKey: PWLPZAGOMVPORD-UHFFFAOYSA-N.

Identity
Molecular formulaC11H11NO3S
Molecular weight237.28 g/mol
IUPAC name3-(1,3-benzothiazol-2-yl)-3-methoxypropanoic acid
InChIKeyPWLPZAGOMVPORD-UHFFFAOYSA-N
SMILESCOC(CC(=O)O)C1=NC2=CC=CC=C2S1

Computed by PubChem (NCBI)