Products 146449-90-3
CAS 146449-90-3 appears in our catalog under these names: 4–Pentyloxyphenylboronic Acid (contains varying amounts of Anhydride), 4-Pentyloxyphenylboronic Acid (contains varying amounts of Anhydride), (4-Pentyloxyphenyl)boronic acid, 97%, 97%, (4-Pentyloxyphenyl)boronic acid, 97%. Offered by: GLPBio, TCI, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 250mg, 25g.
(4-pentoxyphenyl)boronic acid (CAS 146449-90-3) is a chemical compound with the molecular formula C11H17BO3 and a molecular weight of 208.06 g/mol. IUPAC name: (4-pentoxyphenyl)boronic acid. InChIKey: WHFKSJLAGACWMF-UHFFFAOYSA-N.
| Molecular formula | C11H17BO3 |
|---|---|
| Molecular weight | 208.06 g/mol |
| IUPAC name | (4-pentoxyphenyl)boronic acid |
| InChIKey | WHFKSJLAGACWMF-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)OCCCCC)(O)O |
Computed by PubChem (NCBI)
Synonyms:
4-Pentyloxyphenylboronic Acid (contains varying amounts of Anhydride), (4-Pentyloxyphenyl)boronic acid, 4-Pentyloxyphenylboronic acid, 4-(pentyloxy)phenylboronic acid, (4-pentoxyphenyl)boronic Acid, 4-(n-Pentyloxy)benzeneboronic acid, Boronic acid, B-[4-(pentyloxy)phenyl]-, 4-(n-pentyloxy)phenylboronic acid, (4-(pentyloxy)phenyl)boronic acid, (4-Pentyloxyphenyl)boronicacid