(4-Phenoxy-benzoylamino)-acetic acid
cas: 157396-29-7 — see every product listed under this CAS number, including other names
(4-Phenoxy-benzoylamino)-acetic acid (CAS 157396-29-7) is a chemical reagent available from Chemat. Available pack sizes: 5g, 0,5g, 5mg, 25mg, 250mg, 1g, 10g, 25g. Offered by: Biosynth, Chemat.
| brand | Biosynth |
|---|---|
| catalog number | HGA39629-5g |
| cas | 157396-29-7 |
| size | 5g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Biosynth | 5g | price on request | |
| Biosynth | 0,5g | price on request | |
| Chemat | 5mg | 194.00 Pln | |
| Chemat | 25mg | 352.40 Pln | |
| Chemat | 250mg | 779.60 Pln | |
| Chemat | 1g | 1480.40 Pln | |
| Chemat | 5g | 4192.40 Pln | |
| Chemat | 10g | 6117.20 Pln | |
| Chemat | 25g | 11330.00 Pln |
properties
| category | Research Chemicals |
|---|---|
| sub-category 1 | Building Blocks |
| purity | No data |
| delivery time | 3-4 weeks |
2-[(4-phenoxybenzoyl)amino]acetic acid (CAS 157396-29-7) is a chemical compound with the molecular formula C15H13NO4 and a molecular weight of 271.27 g/mol. IUPAC name: 2-[(4-phenoxybenzoyl)amino]acetic acid. InChIKey: RWPWRWSNTGJXQW-UHFFFAOYSA-N.
| Molecular formula | C15H13NO4 |
|---|---|
| Molecular weight | 271.27 g/mol |
| IUPAC name | 2-[(4-phenoxybenzoyl)amino]acetic acid |
| InChIKey | RWPWRWSNTGJXQW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OC2=CC=C(C=C2)C(=O)NCC(=O)O |
Computed by PubChem (NCBI)