Products 1261929-79-6

CAS 1261929-79-6 is the registry number for 3-(4-Ethoxycarbonylphenyl)isonicotinic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 100mg.

Structural formula: {0} (CAS {1})

3-(4-ethoxycarbonylphenyl)pyridine-4-carboxylic acid (CAS 1261929-79-6) is a chemical compound with the molecular formula C15H13NO4 and a molecular weight of 271.27 g/mol. IUPAC name: 3-(4-ethoxycarbonylphenyl)pyridine-4-carboxylic acid. InChIKey: UZOJZRNJACOLHF-UHFFFAOYSA-N.

Identity
Molecular formulaC15H13NO4
Molecular weight271.27 g/mol
IUPAC name3-(4-ethoxycarbonylphenyl)pyridine-4-carboxylic acid
InChIKeyUZOJZRNJACOLHF-UHFFFAOYSA-N
SMILESCCOC(=O)C1=CC=C(C=C1)C2=C(C=CN=C2)C(=O)O

Computed by PubChem (NCBI)