CAS 1261929-79-6 is the registry number for 3-(4-Ethoxycarbonylphenyl)isonicotinic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 100mg.
3-(4-ethoxycarbonylphenyl)pyridine-4-carboxylic acid (CAS 1261929-79-6) is a chemical compound with the molecular formula C15H13NO4 and a molecular weight of 271.27 g/mol. IUPAC name: 3-(4-ethoxycarbonylphenyl)pyridine-4-carboxylic acid. InChIKey: UZOJZRNJACOLHF-UHFFFAOYSA-N.
| Molecular formula | C15H13NO4 |
|---|---|
| Molecular weight | 271.27 g/mol |
| IUPAC name | 3-(4-ethoxycarbonylphenyl)pyridine-4-carboxylic acid |
| InChIKey | UZOJZRNJACOLHF-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC=C(C=C1)C2=C(C=CN=C2)C(=O)O |
Computed by PubChem (NCBI)