cas: 153652-70-1 — see every product listed under this CAS number, including other names
(4S,5R)-3-Benzoyl-2,2-dimethyl-4-phenyloxazolidine-5-carboxylic acid, 95%, 95% (CAS 153652-70-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11HY6J-250mg |
| cas | 153652-70-1 |
| size | 250mg |
| availability | 75g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 194.00 Pln | |
| Chemat | 1g | 472.40 Pln | |
| Chemat | 5g | 1480.40 Pln | |
| Chemat | 25g | 4787.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
(4S,5R)-3-benzoyl-2,2-dimethyl-4-phenyl-1,3-oxazolidine-5-carboxylic acid (CAS 153652-70-1) is a chemical compound with the molecular formula C19H19NO4 and a molecular weight of 325.4 g/mol. IUPAC name: (4S,5R)-3-benzoyl-2,2-dimethyl-4-phenyl-1,3-oxazolidine-5-carboxylic acid. InChIKey: AQOXAQNPPJHPAD-JKSUJKDBSA-N.
| Molecular formula | C19H19NO4 |
|---|---|
| Molecular weight | 325.4 g/mol |
| IUPAC name | (4S,5R)-3-benzoyl-2,2-dimethyl-4-phenyl-1,3-oxazolidine-5-carboxylic acid |
| InChIKey | AQOXAQNPPJHPAD-JKSUJKDBSA-N |
| SMILES | CC1(N([C@H]([C@@H](O1)C(=O)O)C2=CC=CC=C2)C(=O)C3=CC=CC=C3)C |
Computed by PubChem (NCBI)