CAS 186320-19-4 appears in our catalog under these names: 3-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-2-methylpropanoic acid, 95%, 3-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-2-methylpropanoic acid, 97%, Fmoc–DL–beta–aminoisobutyric acid, Fmoc-DL-beta-aminoisobutyric acid, 3-((((9h-Fluoren-9-yl)methoxy)carbonyl)amino)-2-methylpropanoic acid, 97%, 97%. Offered by: Combi-blocks, AmBeed, GLPBio, Biosynth, Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg, 500mg, 2,5g.
3-(9H-fluoren-9-ylmethoxycarbonylamino)-2-methylpropanoic acid (CAS 186320-19-4) is a chemical compound with the molecular formula C19H19NO4 and a molecular weight of 325.4 g/mol. IUPAC name: 3-(9H-fluoren-9-ylmethoxycarbonylamino)-2-methylpropanoic acid. InChIKey: BMUDOYSTGJHGNI-UHFFFAOYSA-N.
| Molecular formula | C19H19NO4 |
|---|---|
| Molecular weight | 325.4 g/mol |
| IUPAC name | 3-(9H-fluoren-9-ylmethoxycarbonylamino)-2-methylpropanoic acid |
| InChIKey | BMUDOYSTGJHGNI-UHFFFAOYSA-N |
| SMILES | CC(CNC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13)C(=O)O |
Computed by PubChem (NCBI)