CAS 174879-28-8 appears in our catalog under these names: Fmoc-dl-2-aminobutyric acid, 95%, 2–((((9H–Fluoren–9–yl)methoxy)carbonyl)amino)butanoic acid, FMOC-DL-2-AMINOBUTYRIC ACID, 98%, 98%, 2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)butanoic acid, 98%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 25g, 5g, 100g, 1g, 10g, 250mg, 15g.
2-(9H-fluoren-9-ylmethoxycarbonylamino)butanoic acid (CAS 174879-28-8) is a chemical compound with the molecular formula C19H19NO4 and a molecular weight of 325.4 g/mol. IUPAC name: 2-(9H-fluoren-9-ylmethoxycarbonylamino)butanoic acid. InChIKey: XQIRYUNKLVPVRR-UHFFFAOYSA-N.
| Molecular formula | C19H19NO4 |
|---|---|
| Molecular weight | 325.4 g/mol |
| IUPAC name | 2-(9H-fluoren-9-ylmethoxycarbonylamino)butanoic acid |
| InChIKey | XQIRYUNKLVPVRR-UHFFFAOYSA-N |
| SMILES | CCC(C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)