CAS 186320-18-3 appears in our catalog under these names: Fmoc-dl-3-aminobutyric acid, 95%, Fmoc-DL-3-aminobutyric acid 97%, FMOC-DL-3-AMINOBUTYRIC ACID, 98%, Fmoc-DL-beta-aminobutyric acid, 3-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)butanoic acid, 97%, 97%. Offered by: Combi-blocks, Ambeed, Fluorochem, Biosynth, Chemat. Available pack sizes: 1g, 10g, 250mg, 5g, 100mg, 2,5g.
3-(9H-fluoren-9-ylmethoxycarbonylamino)butanoic acid (CAS 186320-18-3) is a chemical compound with the molecular formula C19H19NO4 and a molecular weight of 325.4 g/mol. IUPAC name: 3-(9H-fluoren-9-ylmethoxycarbonylamino)butanoic acid. InChIKey: LYMLSPRRJWJJQD-UHFFFAOYSA-N.
| Molecular formula | C19H19NO4 |
|---|---|
| Molecular weight | 325.4 g/mol |
| IUPAC name | 3-(9H-fluoren-9-ylmethoxycarbonylamino)butanoic acid |
| InChIKey | LYMLSPRRJWJJQD-UHFFFAOYSA-N |
| SMILES | CC(CC(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)