CAS 146346-88-5 appears in our catalog under these names: Fmoc-Ala-OMe, 97%, Fmoc–Ala–OMe, Fmoc-L-Ala-OMe 97%, Fmoc-Ala-OMe, 98%(LC-MS),RG, 98%(LC-MS),RG, L-Alanine, N-[(9H-fluoren-9-ylmethoxy)carbonyl]-, methyl ester, 97%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 25g, 1g, 5g, 100g.
Methyl (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoate (CAS 146346-88-5) is a chemical compound with the molecular formula C19H19NO4 and a molecular weight of 325.4 g/mol. IUPAC name: methyl (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoate. InChIKey: NLYFFHNUTFDXLO-LBPRGKRZSA-N.
| Molecular formula | C19H19NO4 |
|---|---|
| Molecular weight | 325.4 g/mol |
| IUPAC name | methyl (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoate |
| InChIKey | NLYFFHNUTFDXLO-LBPRGKRZSA-N |
| SMILES | C[C@@H](C(=O)OC)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)