Products 1820574-90-0

CAS 1820574-90-0 is the registry number for 2-benzyl 3-methyl (3R)-3,4-dihydro-1H-isoquinoline-2,3-dicarboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

2-O-benzyl 3-O-methyl (3R)-3,4-dihydro-1H-isoquinoline-2,3-dicarboxylate (CAS 1820574-90-0) is a chemical compound with the molecular formula C19H19NO4 and a molecular weight of 325.4 g/mol. IUPAC name: 2-O-benzyl 3-O-methyl (3R)-3,4-dihydro-1H-isoquinoline-2,3-dicarboxylate. InChIKey: JHKAOSQDHNSCGQ-QGZVFWFLSA-N.

Identity
Molecular formulaC19H19NO4
Molecular weight325.4 g/mol
IUPAC name2-O-benzyl 3-O-methyl (3R)-3,4-dihydro-1H-isoquinoline-2,3-dicarboxylate
InChIKeyJHKAOSQDHNSCGQ-QGZVFWFLSA-N
SMILESCOC(=O)[C@H]1CC2=CC=CC=C2CN1C(=O)OCC3=CC=CC=C3

Computed by PubChem (NCBI)