cas: 1246633-53-3 — see every product listed under this CAS number, including other names
(5–Fluoro–2–(hydroxymethyl)phenyl)boronic acid (CAS 1246633-53-3) is a chemical reagent available from Chemat. Available pack sizes: 10g, 1g, 250mg, 5g. Offered by: GLPBio.
| brand | GLPBio |
|---|---|
| catalog number | GF51381-10g |
| cas | 1246633-53-3 |
| size | 10g |
| brand | size | price | |
|---|---|---|---|
| GLPBio | 10g | 1182.10 Pln | |
| GLPBio | 1g | 714.05 Pln | |
| GLPBio | 250mg | 559.60 Pln | |
| GLPBio | 5g | 835.75 Pln |
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
[5-fluoro-2-(hydroxymethyl)phenyl]boronic acid (CAS 1246633-53-3) is a chemical compound with the molecular formula C7H8BFO3 and a molecular weight of 169.95 g/mol. IUPAC name: [5-fluoro-2-(hydroxymethyl)phenyl]boronic acid. InChIKey: OBSMVIAXTKAJFM-UHFFFAOYSA-N.
| Molecular formula | C7H8BFO3 |
|---|---|
| Molecular weight | 169.95 g/mol |
| IUPAC name | [5-fluoro-2-(hydroxymethyl)phenyl]boronic acid |
| InChIKey | OBSMVIAXTKAJFM-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)F)CO)(O)O |
Computed by PubChem (NCBI)