cas: 1246633-53-3 — see every product listed under this CAS number, including other names
(5-Fluoro-2-(hydroxymethyl)phenyl)boronic acid, 98% (CAS 1246633-53-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F437088-250MG |
| cas | 1246633-53-3 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 143.72 Pln | |
| Fluorochem | 1g | 227.02 Pln | |
| Fluorochem | 5g | 346.77 Pln | |
| Fluorochem | 10g | 633.13 Pln | |
| Fluorochem | 25g | 1466.17 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
[5-fluoro-2-(hydroxymethyl)phenyl]boronic acid (CAS 1246633-53-3) is a chemical compound with the molecular formula C7H8BFO3 and a molecular weight of 169.95 g/mol. IUPAC name: [5-fluoro-2-(hydroxymethyl)phenyl]boronic acid. InChIKey: OBSMVIAXTKAJFM-UHFFFAOYSA-N.
| Molecular formula | C7H8BFO3 |
|---|---|
| Molecular weight | 169.95 g/mol |
| IUPAC name | [5-fluoro-2-(hydroxymethyl)phenyl]boronic acid |
| InChIKey | OBSMVIAXTKAJFM-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)F)CO)(O)O |
Computed by PubChem (NCBI)