cas: 1072951-39-3 — see every product listed under this CAS number, including other names
(5-(((tert-Butoxycarbonyl)amino)methyl)thiophen-2-yl)boronic acid, 95% (CAS 1072951-39-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F212187-100MG |
| cas | 1072951-39-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 143.72 Pln | |
| Fluorochem | 250mg | 185.37 Pln | |
| Fluorochem | 500mg | 200.99 Pln | |
| Fluorochem | 1g | 221.81 Pln | |
| Fluorochem | 5g | 862.21 Pln | |
| Fluorochem | 10g | 1669.22 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
[5-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]thiophen-2-yl]boronic acid (CAS 1072951-39-3) is a chemical compound with the molecular formula C10H16BNO4S and a molecular weight of 257.12 g/mol. IUPAC name: [5-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]thiophen-2-yl]boronic acid. InChIKey: LCYICDNCCZCYQI-UHFFFAOYSA-N.
| Molecular formula | C10H16BNO4S |
|---|---|
| Molecular weight | 257.12 g/mol |
| IUPAC name | [5-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]thiophen-2-yl]boronic acid |
| InChIKey | LCYICDNCCZCYQI-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(S1)CNC(=O)OC(C)(C)C)(O)O |
Computed by PubChem (NCBI)