cas: 2377611-47-5 — see every product listed under this CAS number, including other names
(5-((tert-Butoxycarbonyl)amino)-2,4-dimethylphenyl)boronic acid, 98% (CAS 2377611-47-5) is a chemical reagent available from Chemat. Available pack sizes: 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A1379124-5g |
| cas | 2377611-47-5 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 9379.30 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
[2,4-dimethyl-5-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]boronic acid (CAS 2377611-47-5) is a chemical compound with the molecular formula C13H20BNO4 and a molecular weight of 265.12 g/mol. IUPAC name: [2,4-dimethyl-5-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]boronic acid. InChIKey: XWJLMCDUFFNXBS-UHFFFAOYSA-N.
| Molecular formula | C13H20BNO4 |
|---|---|
| Molecular weight | 265.12 g/mol |
| IUPAC name | [2,4-dimethyl-5-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]boronic acid |
| InChIKey | XWJLMCDUFFNXBS-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1C)C)NC(=O)OC(C)(C)C)(O)O |
Computed by PubChem (NCBI)