cas: 669051-19-8 — see every product listed under this CAS number, including other names
(5-Bromobenzo[d][1,3]dioxol-4-yl)methanol (CAS 669051-19-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F630072-1G |
| cas | 669051-19-8 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 1330.80 Pln | |
| Fluorochem | 5g | 3850.75 Pln |
| delivery time | 3-4 weeks |
|---|
(5-bromo-1,3-benzodioxol-4-yl)methanol (CAS 669051-19-8) is a chemical compound with the molecular formula C8H7BrO3 and a molecular weight of 231.04 g/mol. IUPAC name: (5-bromo-1,3-benzodioxol-4-yl)methanol. InChIKey: NESPKJAGCRSBSC-UHFFFAOYSA-N.
| Molecular formula | C8H7BrO3 |
|---|---|
| Molecular weight | 231.04 g/mol |
| IUPAC name | (5-bromo-1,3-benzodioxol-4-yl)methanol |
| InChIKey | NESPKJAGCRSBSC-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C(=C(C=C2)Br)CO |
Computed by PubChem (NCBI)