CAS 2491-39-6 appears in our catalog under these names: 2-Bromo-2',4'-dihydroxyacetophenone, 98%, 2–Bromo–2',4'–dihydroxyacetophenone, 2-Bromo-2',4'-dihydroxyacetophenone, >97.0%(T), 2-Bromo-1-(2,4-dihydroxyphenyl)ethanone, 2-BROMO-2',4'-DIHYDROXYACETOPHENONE, 95%. Offered by: Combi-blocks, GLPBio, TCI, Biosynth, Sigma-Aldrich. Available pack sizes: 10g, 5g, 1g, 200mg, 25g.
2-bromo-1-(2,4-dihydroxyphenyl)ethanone (CAS 2491-39-6) is a chemical compound with the molecular formula C8H7BrO3 and a molecular weight of 231.04 g/mol. IUPAC name: 2-bromo-1-(2,4-dihydroxyphenyl)ethanone. InChIKey: RAULLGKGLGXMOM-UHFFFAOYSA-N.
| Molecular formula | C8H7BrO3 |
|---|---|
| Molecular weight | 231.04 g/mol |
| IUPAC name | 2-bromo-1-(2,4-dihydroxyphenyl)ethanone |
| InChIKey | RAULLGKGLGXMOM-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1O)O)C(=O)CBr |
Computed by PubChem (NCBI)