CAS 6642-34-8 appears in our catalog under these names: (6-Bromo-1,3-benzodioxol-5-yl)methanol, 95%, (6–Bromobenzo(d)(1,3)dioxol–5–yl)methanol, (6-Bromobenzo(d)(1,3)dioxol-5-yl)methanol, (6-Bromobenzo[d][1,3]dioxol-5-yl)methanol, 95%, 95%, (6-Bromobenzo[d][1,3]dioxol-5-yl)methanol, 95%. Offered by: Combi-blocks, GLPBio, Biosynth, Chemat, Ambeed. Available pack sizes: 250mg, 10g, 5g, 1g, 2,5g, 100mg, 500mg.
(6-bromo-1,3-benzodioxol-5-yl)methanol (CAS 6642-34-8) is a chemical compound with the molecular formula C8H7BrO3 and a molecular weight of 231.04 g/mol. IUPAC name: (6-bromo-1,3-benzodioxol-5-yl)methanol. InChIKey: XYYBAJXSNPIXTC-UHFFFAOYSA-N.
| Molecular formula | C8H7BrO3 |
|---|---|
| Molecular weight | 231.04 g/mol |
| IUPAC name | (6-bromo-1,3-benzodioxol-5-yl)methanol |
| InChIKey | XYYBAJXSNPIXTC-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C=C(C(=C2)CO)Br |
Computed by PubChem (NCBI)