Products 106134-16-1
CAS 106134-16-1 appears in our catalog under these names: 1-(3-Bromophenyl)-2,2-dihydroxyethan-1-one 95%, 1-(3-Bromophenyl)-2,2-dihydroxyethan-1-one, 95%, 95%, 3-Bromophenylglyoxal hydrate, 95%, 3-Bromophenyl glyoxal hydrate, 95%. Offered by: Ambeed, Chemat, Combi-blocks, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 25g, 100mg, 10g.
2-(3-bromophenyl)-2-oxoacetaldehyde;hydrate (CAS 106134-16-1) is a chemical compound with the molecular formula C8H7BrO3 and a molecular weight of 231.04 g/mol. IUPAC name: 2-(3-bromophenyl)-2-oxoacetaldehyde;hydrate. InChIKey: BSHAAODAJAWMNJ-UHFFFAOYSA-N.
| Molecular formula | C8H7BrO3 |
|---|---|
| Molecular weight | 231.04 g/mol |
| IUPAC name | 2-(3-bromophenyl)-2-oxoacetaldehyde;hydrate |
| InChIKey | BSHAAODAJAWMNJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Br)C(=O)C=O.O |
Computed by PubChem (NCBI)