Products 1879-56-7
CAS 1879-56-7 appears in our catalog under these names: o-Bromophenoxyacetic acid, 98%, o-Bromophenoxyacetic acid, >95% (HPLC), 2-(2-Bromophenoxy)acetic acid 98%, 2-(2-Bromophenoxy)acetic acid, 98%, 98%, (2-Bromo-phenoxy)-acetic acid, 98%. Offered by: Combi-blocks, TRC, Ambeed, Chemat, Fluorochem. Available pack sizes: 10g, 25g, 5g, 1g, 100mg.
2-(2-bromophenoxy)acetic acid (CAS 1879-56-7) is a chemical compound with the molecular formula C8H7BrO3 and a molecular weight of 231.04 g/mol. IUPAC name: 2-(2-bromophenoxy)acetic acid. InChIKey: AZYODYPUWJPKOI-UHFFFAOYSA-N.
| Molecular formula | C8H7BrO3 |
|---|---|
| Molecular weight | 231.04 g/mol |
| IUPAC name | 2-(2-bromophenoxy)acetic acid |
| InChIKey | AZYODYPUWJPKOI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)OCC(=O)O)Br |
Computed by PubChem (NCBI)