CAS 22921-68-2 appears in our catalog under these names: 2-Bromo-5-methoxybenzoic Acid, 2–Bromo–5–methoxybenzoic Acid, 2-Bromo-5-methoxybenzoic acid, 98%, 2-Bromo-5-methoxybenzoic acid, 98+% , 2-Bromo-5-methoxybenzoic acid 98%. Offered by: TRC, GLPBio, Chemat, Combi-blocks, Thermo Scientific (Alfa Aesar). Available pack sizes: 50g, 5g, 100g, 500g, 1kg, 25g, 10g, 250g.
2-bromo-5-methoxybenzoic acid (CAS 22921-68-2) is a chemical compound with the molecular formula C8H7BrO3 and a molecular weight of 231.04 g/mol. IUPAC name: 2-bromo-5-methoxybenzoic acid. InChIKey: ODHJOROUCITYNF-UHFFFAOYSA-N.
| Molecular formula | C8H7BrO3 |
|---|---|
| Molecular weight | 231.04 g/mol |
| IUPAC name | 2-bromo-5-methoxybenzoic acid |
| InChIKey | ODHJOROUCITYNF-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1)Br)C(=O)O |
Computed by PubChem (NCBI)