CAS 617689-07-3 appears in our catalog under these names: 5-Methoxy-2-methylphenylboronic acid, 98%, (5–Methoxy–2–methylphenyl)boronic acid(contains varying amounts of Anhydride), (5-Methoxy-2-methylphenyl)boronic acid, 97%, 97%, (5-Methoxy-2-methylphenyl)boronic acid, 95%, (5-Methoxy-2-methylphenyl)boronic acid, 98%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 250mg, 1g, 100mg, 25mg, 5g, 25g.
(5-methoxy-2-methylphenyl)boronic acid (CAS 617689-07-3) is a chemical compound with the molecular formula C8H11BO3 and a molecular weight of 165.98 g/mol. IUPAC name: (5-methoxy-2-methylphenyl)boronic acid. InChIKey: QUQJFILPCCJEGB-UHFFFAOYSA-N.
| Molecular formula | C8H11BO3 |
|---|---|
| Molecular weight | 165.98 g/mol |
| IUPAC name | (5-methoxy-2-methylphenyl)boronic acid |
| InChIKey | QUQJFILPCCJEGB-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)OC)C)(O)O |
Computed by PubChem (NCBI)