cas: 617689-07-3 — see every product listed under this CAS number, including other names
(5-Methoxy-2-methylphenyl)boronic acid 98% (CAS 617689-07-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1490445-100mg |
| cas | 617689-07-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 220.19 Pln | |
| Ambeed | 250mg | 281.38 Pln | |
| Ambeed | 1g | 670.75 Pln | |
| Ambeed | 5g | 2317.25 Pln | |
| Ambeed | 25g | 8658.50 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A1490445 |
(5-methoxy-2-methylphenyl)boronic acid (CAS 617689-07-3) is a chemical compound with the molecular formula C8H11BO3 and a molecular weight of 165.98 g/mol. IUPAC name: (5-methoxy-2-methylphenyl)boronic acid. InChIKey: QUQJFILPCCJEGB-UHFFFAOYSA-N.
| Molecular formula | C8H11BO3 |
|---|---|
| Molecular weight | 165.98 g/mol |
| IUPAC name | (5-methoxy-2-methylphenyl)boronic acid |
| InChIKey | QUQJFILPCCJEGB-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)OC)C)(O)O |
Computed by PubChem (NCBI)