cas: 936353-84-3 — see every product listed under this CAS number, including other names
(6–(4–Methylpiperazin–1–yl)pyridin–3–yl)boronic acid (CAS 936353-84-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 1g, 250mg, 5g. Offered by: GLPBio.
| brand | GLPBio |
|---|---|
| catalog number | GF51302-100mg |
| cas | 936353-84-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| GLPBio | 100mg | 522.15 Pln | |
| GLPBio | 1g | 728.09 Pln | |
| GLPBio | 250mg | 568.96 Pln | |
| GLPBio | 5g | 1556.54 Pln |
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
[6-(4-methylpiperazin-1-yl)-3-pyridinyl]boronic acid (CAS 936353-84-3) is a chemical compound with the molecular formula C10H16BN3O2 and a molecular weight of 221.07 g/mol. IUPAC name: [6-(4-methylpiperazin-1-yl)-3-pyridinyl]boronic acid. InChIKey: YGZOCDXCJWHNQN-UHFFFAOYSA-N.
| Molecular formula | C10H16BN3O2 |
|---|---|
| Molecular weight | 221.07 g/mol |
| IUPAC name | [6-(4-methylpiperazin-1-yl)-3-pyridinyl]boronic acid |
| InChIKey | YGZOCDXCJWHNQN-UHFFFAOYSA-N |
| SMILES | B(C1=CN=C(C=C1)N2CCN(CC2)C)(O)O |
Computed by PubChem (NCBI)