cas: 936353-84-3 — see every product listed under this CAS number, including other names
(6-(4-Methylpiperazin-1-yl)pyridin-3-yl)boronic acid, 96% (CAS 936353-84-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F239665-250MG |
| cas | 936353-84-3 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 190.58 Pln | |
| Fluorochem | 1g | 341.56 Pln | |
| Fluorochem | 5g | 1252.70 Pln |
| purity | 96% |
|---|---|
| delivery time | 1-2 weeks |
[6-(4-methylpiperazin-1-yl)-3-pyridinyl]boronic acid (CAS 936353-84-3) is a chemical compound with the molecular formula C10H16BN3O2 and a molecular weight of 221.07 g/mol. IUPAC name: [6-(4-methylpiperazin-1-yl)-3-pyridinyl]boronic acid. InChIKey: YGZOCDXCJWHNQN-UHFFFAOYSA-N.
| Molecular formula | C10H16BN3O2 |
|---|---|
| Molecular weight | 221.07 g/mol |
| IUPAC name | [6-(4-methylpiperazin-1-yl)-3-pyridinyl]boronic acid |
| InChIKey | YGZOCDXCJWHNQN-UHFFFAOYSA-N |
| SMILES | B(C1=CN=C(C=C1)N2CCN(CC2)C)(O)O |
Computed by PubChem (NCBI)