cas: 1072945-86-8 — see every product listed under this CAS number, including other names
(6–(Methoxycarbonyl)pyridin–3–yl)boronic acid (CAS 1072945-86-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 1g, 250mg, 5g. Offered by: GLPBio.
| brand | GLPBio |
|---|---|
| catalog number | GF51293-100mg |
| cas | 1072945-86-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| GLPBio | 100mg | 536.19 Pln | |
| GLPBio | 1g | 943.40 Pln | |
| GLPBio | 250mg | 597.04 Pln | |
| GLPBio | 5g | 2525.41 Pln |
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
(6-methoxycarbonyl-3-pyridinyl)boronic acid (CAS 1072945-86-8) is a chemical compound with the molecular formula C7H8BNO4 and a molecular weight of 180.96 g/mol. IUPAC name: (6-methoxycarbonyl-3-pyridinyl)boronic acid. InChIKey: OJRWQJNSMWIFMD-UHFFFAOYSA-N.
| Molecular formula | C7H8BNO4 |
|---|---|
| Molecular weight | 180.96 g/mol |
| IUPAC name | (6-methoxycarbonyl-3-pyridinyl)boronic acid |
| InChIKey | OJRWQJNSMWIFMD-UHFFFAOYSA-N |
| SMILES | B(C1=CN=C(C=C1)C(=O)OC)(O)O |
Computed by PubChem (NCBI)