CAS 116378-40-6 appears in our catalog under these names: 3-Amino-5-carboxylphenylboronic acid, 98%, 3–Amino–5–carboxylphenylboronic acid(contains varying amounts of Anhydride), 3-Amino-5-boronobenzoic acid 98%, 3-Amino-5-boronobenzoic acid, 98%, 98%, 3-Amino-5-boronobenzoic acid, 97%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 1g, 250mg, 100mg.
3-amino-5-boronobenzoic acid (CAS 116378-40-6) is a chemical compound with the molecular formula C7H8BNO4 and a molecular weight of 180.96 g/mol. IUPAC name: 3-amino-5-boronobenzoic acid. InChIKey: VVQAAMZMJNXCOP-UHFFFAOYSA-N.
| Molecular formula | C7H8BNO4 |
|---|---|
| Molecular weight | 180.96 g/mol |
| IUPAC name | 3-amino-5-boronobenzoic acid |
| InChIKey | VVQAAMZMJNXCOP-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1)N)C(=O)O)(O)O |
Computed by PubChem (NCBI)