Products 1228829-54-6
CAS 1228829-54-6 appears in our catalog under these names: 2–Methyl–4–nitrophenylboronic acid, 2-Methyl-4-nitrophenylboronic Acid, 96%, 96%, 2-Methyl-4-nitrophenylboronic acid, 98%, 2-Methyl-4-nitrophenylboronic acid, 96%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g.
(2-methyl-4-nitrophenyl)boronic acid (CAS 1228829-54-6) is a chemical compound with the molecular formula C7H8BNO4 and a molecular weight of 180.96 g/mol. IUPAC name: (2-methyl-4-nitrophenyl)boronic acid. InChIKey: MTRNMFMWHXCMFQ-UHFFFAOYSA-N.
| Molecular formula | C7H8BNO4 |
|---|---|
| Molecular weight | 180.96 g/mol |
| IUPAC name | (2-methyl-4-nitrophenyl)boronic acid |
| InChIKey | MTRNMFMWHXCMFQ-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)[N+](=O)[O-])C)(O)O |
Computed by PubChem (NCBI)