Products 1072945-60-8
CAS 1072945-60-8 appears in our catalog under these names: 2-Methyl-3-nitrophenylboronic acid, 95%, (2–Methyl–3–nitrophenyl)boronic acid, (2-Methyl-3-nitrophenyl)boronic acid, 98%, 98%, 2-Methyl-3-nitrophenylboronic acid, 97%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 100mg, 250mg.
(2-methyl-3-nitrophenyl)boronic acid (CAS 1072945-60-8) is a chemical compound with the molecular formula C7H8BNO4 and a molecular weight of 180.96 g/mol. IUPAC name: (2-methyl-3-nitrophenyl)boronic acid. InChIKey: OZOLRGZAVBQRBG-UHFFFAOYSA-N.
| Molecular formula | C7H8BNO4 |
|---|---|
| Molecular weight | 180.96 g/mol |
| IUPAC name | (2-methyl-3-nitrophenyl)boronic acid |
| InChIKey | OZOLRGZAVBQRBG-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=CC=C1)[N+](=O)[O-])C)(O)O |
Computed by PubChem (NCBI)