Products 143697-03-4
CAS 143697-03-4 appears in our catalog under these names: 4-Methyl-2-nitrophenylboronic acid, 97%, (4-Methyl-2-nitrophenyl)boronic acid 98%, (4-Methyl-2-nitrophenyl)boronic acid, 95%, (4-Methyl-2-nitrophenyl)boronic acid, 98%, 98%. Offered by: Combi-blocks, Ambeed, Fluorochem, Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg, 10g.
(4-methyl-2-nitrophenyl)boronic acid (CAS 143697-03-4) is a chemical compound with the molecular formula C7H8BNO4 and a molecular weight of 180.96 g/mol. IUPAC name: (4-methyl-2-nitrophenyl)boronic acid. InChIKey: AYHIVXNOPOXRIZ-UHFFFAOYSA-N.
| Molecular formula | C7H8BNO4 |
|---|---|
| Molecular weight | 180.96 g/mol |
| IUPAC name | (4-methyl-2-nitrophenyl)boronic acid |
| InChIKey | AYHIVXNOPOXRIZ-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)C)[N+](=O)[O-])(O)O |
Computed by PubChem (NCBI)