CAS 1310404-89-7 is the registry number for (3-(Methoxycarbonyl)pyridin-2-yl)boronic acid, 95+%. Offered by: Chemat Brand. Available pack sizes: on request.
(3-methoxycarbonyl-2-pyridinyl)boronic acid (CAS 1310404-89-7) is a chemical compound with the molecular formula C7H8BNO4 and a molecular weight of 180.96 g/mol. IUPAC name: (3-methoxycarbonyl-2-pyridinyl)boronic acid. InChIKey: UUVDDYLZAQNPFL-UHFFFAOYSA-N.
| Molecular formula | C7H8BNO4 |
|---|---|
| Molecular weight | 180.96 g/mol |
| IUPAC name | (3-methoxycarbonyl-2-pyridinyl)boronic acid |
| InChIKey | UUVDDYLZAQNPFL-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC=N1)C(=O)OC)(O)O |
Computed by PubChem (NCBI)