cas: 60201-22-1 — see every product listed under this CAS number, including other names
(6-Methoxynaphthalen-2-yl)methanol, 98% (CAS 60201-22-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F660230-100MG |
| cas | 60201-22-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 247.85 Pln | |
| Fluorochem | 250mg | 372.80 Pln | |
| Fluorochem | 1g | 544.62 Pln | |
| Fluorochem | 5g | 1294.35 Pln | |
| Fluorochem | 10g | 2434.58 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
(6-methoxynaphthalen-2-yl)methanol (CAS 60201-22-1) is a chemical compound with the molecular formula C12H12O2 and a molecular weight of 188.22 g/mol. IUPAC name: (6-methoxynaphthalen-2-yl)methanol. InChIKey: YKZCYRHZTSJCAO-UHFFFAOYSA-N.
| Molecular formula | C12H12O2 |
|---|---|
| Molecular weight | 188.22 g/mol |
| IUPAC name | (6-methoxynaphthalen-2-yl)methanol |
| InChIKey | YKZCYRHZTSJCAO-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)C=C(C=C2)CO |
Computed by PubChem (NCBI)