CAS 27394-81-6 appears in our catalog under these names: 5-(4-Methoxy-phenyl)-penta-2,4-dienal, 95%, 4-Methoxycinnamylidene acetaldehyde, 4-Methoxycinnamylidene acetaldehyde, min. 95 %, 500 mg, 4-Methoxycinnamylidene acetaldehyde, min. 95 %, 1 g, 4-Methoxycinnamylidene acetaldehyde, min. 95 %, 2 g. Offered by: Combi-blocks, Biosynth, Roth. Available pack sizes: 1g, 25g, 10g, 5g, 0,5g, 2g, 500mg.
(2E,4E)-5-(4-methoxyphenyl)penta-2,4-dienal (CAS 27394-81-6) is a chemical compound with the molecular formula C12H12O2 and a molecular weight of 188.22 g/mol. IUPAC name: (2E,4E)-5-(4-methoxyphenyl)penta-2,4-dienal. InChIKey: IMYIHKBGPIBXFG-ZUVMSYQZSA-N.
| Molecular formula | C12H12O2 |
|---|---|
| Molecular weight | 188.22 g/mol |
| IUPAC name | (2E,4E)-5-(4-methoxyphenyl)penta-2,4-dienal |
| InChIKey | IMYIHKBGPIBXFG-ZUVMSYQZSA-N |
| SMILES | COC1=CC=C(C=C1)/C=C/C=C/C=O |
Computed by PubChem (NCBI)