CAS 14002-91-6 appears in our catalog under these names: 4,5,7-Trimethylcoumarin, 98%, 4,5,7-Trimethyl-2H-chromen-2-one, 95+%, 4,5,7-Trimethylcoumarin. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 250mg, 25g, 10g, 5g, 1g, 2g.
4,5,7-trimethylchromen-2-one (CAS 14002-91-6) is a chemical compound with the molecular formula C12H12O2 and a molecular weight of 188.22 g/mol. IUPAC name: 4,5,7-trimethylchromen-2-one. InChIKey: PUBIEFXQKSKEBE-UHFFFAOYSA-N.
| Molecular formula | C12H12O2 |
|---|---|
| Molecular weight | 188.22 g/mol |
| IUPAC name | 4,5,7-trimethylchromen-2-one |
| InChIKey | PUBIEFXQKSKEBE-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C2C(=CC(=O)OC2=C1)C)C |
Computed by PubChem (NCBI)