Products 1823331-06-1

CAS 1823331-06-1 is the registry number for 4-(Bicyclo[1.1.1]pentan-1-yl)benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg.

Structural formula: {0} (CAS {1})

4-(1-bicyclo[1.1.1]pentanyl)benzoic acid (CAS 1823331-06-1) is a chemical compound with the molecular formula C12H12O2 and a molecular weight of 188.22 g/mol. IUPAC name: 4-(1-bicyclo[1.1.1]pentanyl)benzoic acid. InChIKey: RLBULJYSXOZSPR-UHFFFAOYSA-N.

Identity
Molecular formulaC12H12O2
Molecular weight188.22 g/mol
IUPAC name4-(1-bicyclo[1.1.1]pentanyl)benzoic acid
InChIKeyRLBULJYSXOZSPR-UHFFFAOYSA-N
SMILESC1C2CC1(C2)C3=CC=C(C=C3)C(=O)O

Computed by PubChem (NCBI)