CAS 150788-85-5 is the registry number for 6-Ethoxynaphthalen-2-ol, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
6-ethoxynaphthalen-2-ol (CAS 150788-85-5) is a chemical compound with the molecular formula C12H12O2 and a molecular weight of 188.22 g/mol. IUPAC name: 6-ethoxynaphthalen-2-ol. InChIKey: WIIBBUOXRNBMDS-UHFFFAOYSA-N.
| Molecular formula | C12H12O2 |
|---|---|
| Molecular weight | 188.22 g/mol |
| IUPAC name | 6-ethoxynaphthalen-2-ol |
| InChIKey | WIIBBUOXRNBMDS-UHFFFAOYSA-N |
| SMILES | CCOC1=CC2=C(C=C1)C=C(C=C2)O |
Computed by PubChem (NCBI)