CAS 15817-85-3 appears in our catalog under these names: 1-(3-Ethylbenzofuran-2-yl)ethanone, 95%, 1-(3-Ethyl-1-benzofuran-2-yl)ethanone, 95%. Offered by: AmBeed, Combi-blocks. Available pack sizes: 10g, 5g, 250mg, 1g, 100mg.
1-(3-ethyl-1-benzofuran-2-yl)ethanone (CAS 15817-85-3) is a chemical compound with the molecular formula C12H12O2 and a molecular weight of 188.22 g/mol. IUPAC name: 1-(3-ethyl-1-benzofuran-2-yl)ethanone. InChIKey: UZSCWWHVZCNFKQ-UHFFFAOYSA-N.
| Molecular formula | C12H12O2 |
|---|---|
| Molecular weight | 188.22 g/mol |
| IUPAC name | 1-(3-ethyl-1-benzofuran-2-yl)ethanone |
| InChIKey | UZSCWWHVZCNFKQ-UHFFFAOYSA-N |
| SMILES | CCC1=C(OC2=CC=CC=C21)C(=O)C |
Computed by PubChem (NCBI)